C18H35NOS — CID 154087906
2-(1-dodecylsulfanylpropan-2-yl)-4,5-dihydro-1,3-oxazole (PubChem CID 154087906) has the molecular formula C18H35NOS and a molecular weight of 313.55 g/mol. Its IUPAC name is 2-(1-dodecylsulfanylpropan-2-yl)-4,5-dihydro-1,3-oxazole.
| Compound Name | 2-(1-dodecylsulfanylpropan-2-yl)-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 154087906 |
| Molecular Formula | C18H35NOS |
| Molecular Weight | 313.55 g/mol |
| Exact Mass | 313.24 |
| IUPAC Name | 2-(1-dodecylsulfanylpropan-2-yl)-4,5-dihydro-1,3-oxazole |
| SMILES | CCCCCCCCCCCCSCC(C)C1=NCCO1 |
| InChI | InChI=1S/C18H35NOS/c1-3-4-5-6-7-8-9-10-11-12-15-21-16-17(2)18-19-13-14-20-18/h17H,3-16H2,1-2H3 |
| InChIKey | UJFPWTWHKKVRHN-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.55 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|