C13H25NO — CID 19825999
2-decan-2-yl-4,5-dihydro-1,3-oxazole (PubChem CID 19825999) has the molecular formula C13H25NO and a molecular weight of 211.35 g/mol. Its IUPAC name is 2-decan-2-yl-4,5-dihydro-1,3-oxazole.
| Compound Name | 2-decan-2-yl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 19825999 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | 2-decan-2-yl-4,5-dihydro-1,3-oxazole |
| SMILES | CCCCCCCCC(C)C1=NCCO1 |
| InChI | InChI=1S/C13H25NO/c1-3-4-5-6-7-8-9-12(2)13-14-10-11-15-13/h12H,3-11H2,1-2H3 |
| InChIKey | KQKKCKFQIBQVHV-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|