C13H25NO2 — CID 22413854
2-(4,5-dihydro-1,3-oxazol-2-yl)decan-1-ol (PubChem CID 22413854) has the molecular formula C13H25NO2 and a molecular weight of 227.35 g/mol. Its IUPAC name is 2-(4,5-dihydro-1,3-oxazol-2-yl)decan-1-ol.
| Compound Name | 2-(4,5-dihydro-1,3-oxazol-2-yl)decan-1-ol |
|---|---|
| PubChem CID | 22413854 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | 2-(4,5-dihydro-1,3-oxazol-2-yl)decan-1-ol |
| SMILES | CCCCCCCCC(CO)C1=NCCO1 |
| InChI | InChI=1S/C13H25NO2/c1-2-3-4-5-6-7-8-12(11-15)13-14-9-10-16-13/h12,15H,2-11H2,1H3 |
| InChIKey | JYJWHGBLHDDMCY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|