C15H26N2O — CID 155019743
2-undecan-5-yl-4,5-dihydro-1,3-oxazole-4-carbonitrile (PubChem CID 155019743) has the molecular formula C15H26N2O and a molecular weight of 250.39 g/mol. Its IUPAC name is 2-undecan-5-yl-4,5-dihydro-1,3-oxazole-4-carbonitrile.
| Compound Name | 2-undecan-5-yl-4,5-dihydro-1,3-oxazole-4-carbonitrile |
|---|---|
| PubChem CID | 155019743 |
| Molecular Formula | C15H26N2O |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.20 |
| IUPAC Name | 2-undecan-5-yl-4,5-dihydro-1,3-oxazole-4-carbonitrile |
| SMILES | CCCCCCC(CCCC)C1=NC(C#N)CO1 |
| InChI | InChI=1S/C15H26N2O/c1-3-5-7-8-10-13(9-6-4-2)15-17-14(11-16)12-18-15/h13-14H,3-10,12H2,1-2H3 |
| InChIKey | AYVLUEWOWFBMGK-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 45.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|