C23H31NO4 — CID 171472685
3-[7-(4,5-dihydro-1,3-oxazol-2-yl)decoxy]-4-methylchromen-2-one (PubChem CID 171472685) has the molecular formula C23H31NO4 and a molecular weight of 385.50 g/mol. Its IUPAC name is 3-[7-(4,5-dihydro-1,3-oxazol-2-yl)decoxy]-4-methylchromen-2-one.
| Compound Name | 3-[7-(4,5-dihydro-1,3-oxazol-2-yl)decoxy]-4-methylchromen-2-one |
|---|---|
| PubChem CID | 171472685 |
| Molecular Formula | C23H31NO4 |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | 3-[7-(4,5-dihydro-1,3-oxazol-2-yl)decoxy]-4-methylchromen-2-one |
| SMILES | CCCC(CCCCCCOc1c(C)c2ccccc2oc1=O)C1=NCCO1 |
| InChI | InChI=1S/C23H31NO4/c1-3-10-18(22-24-14-16-27-22)11-6-4-5-9-15-26-21-17(2)19-12-7-8-13-20(19)28-23(21)25/h7-8,12-13,18H,3-6,9-11,14-16H2,1-2H3 |
| InChIKey | UHCAGQSHIWFPAX-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 61.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|