C15H29NO2 — CID 19844010
(2-decan-2-yl-4-methyl-5H-1,3-oxazol-4-yl)methanol (PubChem CID 19844010) has the molecular formula C15H29NO2 and a molecular weight of 255.40 g/mol. Its IUPAC name is (2-decan-2-yl-4-methyl-5H-1,3-oxazol-4-yl)methanol.
| Compound Name | (2-decan-2-yl-4-methyl-5H-1,3-oxazol-4-yl)methanol |
|---|---|
| PubChem CID | 19844010 |
| Molecular Formula | C15H29NO2 |
| Molecular Weight | 255.40 g/mol |
| Exact Mass | 255.22 |
| IUPAC Name | (2-decan-2-yl-4-methyl-5H-1,3-oxazol-4-yl)methanol |
| SMILES | CCCCCCCCC(C)C1=NC(C)(CO)CO1 |
| InChI | InChI=1S/C15H29NO2/c1-4-5-6-7-8-9-10-13(2)14-16-15(3,11-17)12-18-14/h13,17H,4-12H2,1-3H3 |
| InChIKey | BANMMYXMVXFCOX-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|