C18H27NO — CID 10378605
2-(2-heptan-2-ylphenyl)-4,4-dimethyl-5H-1,3-oxazole (PubChem CID 10378605) has the molecular formula C18H27NO and a molecular weight of 273.42 g/mol. Its IUPAC name is 2-(2-heptan-2-ylphenyl)-4,4-dimethyl-5H-1,3-oxazole.
| Compound Name | 2-(2-heptan-2-ylphenyl)-4,4-dimethyl-5H-1,3-oxazole |
|---|---|
| PubChem CID | 10378605 |
| Molecular Formula | C18H27NO |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | 2-(2-heptan-2-ylphenyl)-4,4-dimethyl-5H-1,3-oxazole |
| SMILES | CCCCCC(C)c1ccccc1C1=NC(C)(C)CO1 |
| InChI | InChI=1S/C18H27NO/c1-5-6-7-10-14(2)15-11-8-9-12-16(15)17-19-18(3,4)13-20-17/h8-9,11-12,14H,5-7,10,13H2,1-4H3 |
| InChIKey | AOCDSLNGFUNGCL-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|