About 1,9-dihydrofluoren-1-ide;1H-inden-1-ide;titanium(2+)
1,9-dihydrofluoren-1-ide;1H-inden-1-ide;titanium(2+) (PubChem CID 154095887) has the molecular formula C22H16Ti
and a molecular weight of 328.24 g/mol. Its IUPAC name is 1,9-dihydrofluoren-1-ide;1H-inden-1-ide;titanium(2+).
Molecular Properties
| Compound Name | 1,9-dihydrofluoren-1-ide;1H-inden-1-ide;titanium(2+) |
| PubChem CID | 154095887 |
| Molecular Formula | C22H16Ti |
| Molecular Weight | 328.24 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 1,9-dihydrofluoren-1-ide;1H-inden-1-ide;titanium(2+) |
| SMILES | [Ti+2].[c-]1cccc2c1Cc1ccccc1-2.c1ccc2[cH-]ccc2c1 |
| InChI | InChI=1S/C13H9.C9H7.Ti/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-2-5-9-7-3-6-8(9)4-1;/h1-5,7-8H,9H2;1-7H;/q2*-1;+2 |
| InChIKey | XBUOHUNPJUQKMQ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.24 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1,9-dihydrofluoren-1-ide;1H-inden-1-ide;titanium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,9-dihydrofluoren-1-ide;1H-inden-1-ide;titanium(2+)?
The IUPAC name of 1,9-dihydrofluoren-1-ide;1H-inden-1-ide;titanium(2+) (CID 154095887) is 1,9-dihydrofluoren-1-ide;1H-inden-1-ide;titanium(2+).
What is the SMILES notation for 1,9-dihydrofluoren-1-ide;1H-inden-1-ide;titanium(2+)?
The canonical SMILES for 1,9-dihydrofluoren-1-ide;1H-inden-1-ide;titanium(2+) is [Ti+2].[c-]1cccc2c1Cc1ccccc1-2.c1ccc2[cH-]ccc2c1.
What is the InChIKey of 1,9-dihydrofluoren-1-ide;1H-inden-1-ide;titanium(2+)?
The InChIKey is XBUOHUNPJUQKMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9.C9H7.Ti/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-2-5-9-7-3-6-8(9)4-1;/h1-5,7-8H,9H2;1-7H;/q2*-1;+2.
What are the key properties of 1,9-dihydrofluoren-1-ide;1H-inden-1-ide;titanium(2+)?
1,9-dihydrofluoren-1-ide;1H-inden-1-ide;titanium(2+) has a molecular weight of 328.24 g/mol, XLogP of 5.61, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,9-dihydrofluoren-1-ide;1H-inden-1-ide;titanium(2+) is sourced from PubChem (CID 154095887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).