C22H16Ti — CID 154095887
1,9-dihydrofluoren-1-ide;1H-inden-1-ide;titanium(2+) (PubChem CID 154095887) has the molecular formula C22H16Ti and a molecular weight of 328.24 g/mol. Its IUPAC name is 1,9-dihydrofluoren-1-ide;1H-inden-1-ide;titanium(2+).
| Compound Name | 1,9-dihydrofluoren-1-ide;1H-inden-1-ide;titanium(2+) |
|---|---|
| PubChem CID | 154095887 |
| Molecular Formula | C22H16Ti |
| Molecular Weight | 328.24 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 1,9-dihydrofluoren-1-ide;1H-inden-1-ide;titanium(2+) |
| SMILES | [Ti+2].[c-]1cccc2c1Cc1ccccc1-2.c1ccc2[cH-]ccc2c1 |
| InChI | InChI=1S/C13H9.C9H7.Ti/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-2-5-9-7-3-6-8(9)4-1;/h1-5,7-8H,9H2;1-7H;/q2*-1;+2 |
| InChIKey | XBUOHUNPJUQKMQ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.24 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|