C13H9Cl3V — CID 173274804
1,9-dihydrofluoren-1-ide;vanadium(4+);trichloride (PubChem CID 173274804) has the molecular formula C13H9Cl3V and a molecular weight of 322.52 g/mol. Its IUPAC name is 1,9-dihydrofluoren-1-ide;vanadium(4+);trichloride.
| Compound Name | 1,9-dihydrofluoren-1-ide;vanadium(4+);trichloride |
|---|---|
| PubChem CID | 173274804 |
| Molecular Formula | C13H9Cl3V |
| Molecular Weight | 322.52 g/mol |
| Exact Mass | 320.92 |
| IUPAC Name | 1,9-dihydrofluoren-1-ide;vanadium(4+);trichloride |
| SMILES | [Cl-].[Cl-].[Cl-].[V+4].[c-]1cccc2c1Cc1ccccc1-2 |
| InChI | InChI=1S/C13H9.3ClH.V/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;;;;/h1-5,7-8H,9H2;3*1H;/q-1;;;;+4/p-3 |
| InChIKey | DILKZHIXZPHBSL-UHFFFAOYSA-K |
| XLogP | -5.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.52 |
| LogP ≤ 5 | -5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|