C25H36Ti — CID 150363800
butane;1,9-dihydrofluoren-1-ide;titanium(4+) (PubChem CID 150363800) has the molecular formula C25H36Ti and a molecular weight of 384.43 g/mol. Its IUPAC name is butane;1,9-dihydrofluoren-1-ide;titanium(4+).
| Compound Name | butane;1,9-dihydrofluoren-1-ide;titanium(4+) |
|---|---|
| PubChem CID | 150363800 |
| Molecular Formula | C25H36Ti |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | butane;1,9-dihydrofluoren-1-ide;titanium(4+) |
| SMILES | [CH2-]CCC.[CH2-]CCC.[CH2-]CCC.[Ti+4].[c-]1cccc2c1Cc1ccccc1-2 |
| InChI | InChI=1S/C13H9.3C4H9.Ti/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;3*1-3-4-2;/h1-5,7-8H,9H2;3*1,3-4H2,2H3;/q4*-1;+4 |
| InChIKey | HTJKNMMTJPJPKV-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|