C28H22Cl2Zr-2 — CID 87137061
dichloro(ethylidene)zirconium;bis(1,9-dihydrofluoren-1-ide) (PubChem CID 87137061) has the molecular formula C28H22Cl2Zr-2 and a molecular weight of 520.61 g/mol. Its IUPAC name is dichloro(ethylidene)zirconium;bis(1,9-dihydrofluoren-1-ide).
| Compound Name | dichloro(ethylidene)zirconium;bis(1,9-dihydrofluoren-1-ide) |
|---|---|
| PubChem CID | 87137061 |
| Molecular Formula | C28H22Cl2Zr-2 |
| Molecular Weight | 520.61 g/mol |
| Exact Mass | 518.02 |
| IUPAC Name | dichloro(ethylidene)zirconium;bis(1,9-dihydrofluoren-1-ide) |
| SMILES | CC=[Zr](Cl)Cl.[c-]1cccc2c1Cc1ccccc1-2.[c-]1cccc2c1Cc1ccccc1-2 |
| InChI | InChI=1S/2C13H9.C2H4.2ClH.Zr/c2*1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-2;;;/h2*1-5,7-8H,9H2;1H,2H3;2*1H;/q2*-1;;;;+2/p-2 |
| InChIKey | CTZQPHYMUBIFLW-UHFFFAOYSA-L |
| XLogP | 7.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.61 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|