C34H26Hf — CID 163641961
bis(1,9-dihydrofluoren-1-ide);1-phenylethylidenehafnium(2+) (PubChem CID 163641961) has the molecular formula C34H26Hf and a molecular weight of 613.07 g/mol. Its IUPAC name is bis(1,9-dihydrofluoren-1-ide);1-phenylethylidenehafnium(2+).
| Compound Name | bis(1,9-dihydrofluoren-1-ide);1-phenylethylidenehafnium(2+) |
|---|---|
| PubChem CID | 163641961 |
| Molecular Formula | C34H26Hf |
| Molecular Weight | 613.07 g/mol |
| Exact Mass | 614.15 |
| IUPAC Name | bis(1,9-dihydrofluoren-1-ide);1-phenylethylidenehafnium(2+) |
| SMILES | CC(=[Hf+2])c1ccccc1.[c-]1cccc2c1Cc1ccccc1-2.[c-]1cccc2c1Cc1ccccc1-2 |
| InChI | InChI=1S/2C13H9.C8H8.Hf/c2*1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-2-8-6-4-3-5-7-8;/h2*1-5,7-8H,9H2;3-7H,1H3;/q2*-1;;+2 |
| InChIKey | NBQMXSBPNFDLAV-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.07 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|