C26H27NO3 — CID 154099548
4-[3-[benzyl(propan-2-yl)amino]-2-hydroxypropoxy]fluoren-9-one (PubChem CID 154099548) has the molecular formula C26H27NO3 and a molecular weight of 401.51 g/mol. Its IUPAC name is 4-[3-[benzyl(propan-2-yl)amino]-2-hydroxypropoxy]fluoren-9-one.
| Compound Name | 4-[3-[benzyl(propan-2-yl)amino]-2-hydroxypropoxy]fluoren-9-one |
|---|---|
| PubChem CID | 154099548 |
| Molecular Formula | C26H27NO3 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 4-[3-[benzyl(propan-2-yl)amino]-2-hydroxypropoxy]fluoren-9-one |
| SMILES | CC(C)N(Cc1ccccc1)CC(O)COc1cccc2c1-c1ccccc1C2=O |
| InChI | InChI=1S/C26H27NO3/c1-18(2)27(15-19-9-4-3-5-10-19)16-20(28)17-30-24-14-8-13-23-25(24)21-11-6-7-12-22(21)26(23)29/h3-14,18,20,28H,15-17H2,1-2H3 |
| InChIKey | OPZNFCOCXAULQF-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |