C12H25NO7Si — CID 154101002
dimethyl 2-[2,2-dimethoxyethoxysilyl(ethyl)amino]butanedioate (PubChem CID 154101002) has the molecular formula C12H25NO7Si and a molecular weight of 323.42 g/mol. Its IUPAC name is dimethyl 2-[2,2-dimethoxyethoxysilyl(ethyl)amino]butanedioate.
| Compound Name | dimethyl 2-[2,2-dimethoxyethoxysilyl(ethyl)amino]butanedioate |
|---|---|
| PubChem CID | 154101002 |
| Molecular Formula | C12H25NO7Si |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | dimethyl 2-[2,2-dimethoxyethoxysilyl(ethyl)amino]butanedioate |
| SMILES | CCN([SiH2]OCC(OC)OC)C(CC(=O)OC)C(=O)OC |
| InChI | InChI=1S/C12H25NO7Si/c1-6-13(21-20-8-11(17-3)18-4)9(12(15)19-5)7-10(14)16-2/h9,11H,6-8,21H2,1-5H3 |
| InChIKey | GKFSAXQNANCDFK-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|