C13H27NO7Si — CID 154110369
dimethyl 2-[2,2-dimethoxyethoxysilyl(propyl)amino]butanedioate (PubChem CID 154110369) has the molecular formula C13H27NO7Si and a molecular weight of 337.45 g/mol. Its IUPAC name is dimethyl 2-[2,2-dimethoxyethoxysilyl(propyl)amino]butanedioate.
| Compound Name | dimethyl 2-[2,2-dimethoxyethoxysilyl(propyl)amino]butanedioate |
|---|---|
| PubChem CID | 154110369 |
| Molecular Formula | C13H27NO7Si |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | dimethyl 2-[2,2-dimethoxyethoxysilyl(propyl)amino]butanedioate |
| SMILES | CCCN([SiH2]OCC(OC)OC)C(CC(=O)OC)C(=O)OC |
| InChI | InChI=1S/C13H27NO7Si/c1-6-7-14(22-21-9-12(18-3)19-4)10(13(16)20-5)8-11(15)17-2/h10,12H,6-9,22H2,1-5H3 |
| InChIKey | MJQIOAGDWIWKCN-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|