About dimethyl 2-[2,2-dimethoxyethoxysilyl(propyl)amino]butanedioate
dimethyl 2-[2,2-dimethoxyethoxysilyl(propyl)amino]butanedioate (PubChem CID 154110369) has the molecular formula C13H27NO7Si
and a molecular weight of 337.45 g/mol. Its IUPAC name is dimethyl 2-[2,2-dimethoxyethoxysilyl(propyl)amino]butanedioate.
Molecular Properties
| Compound Name | dimethyl 2-[2,2-dimethoxyethoxysilyl(propyl)amino]butanedioate |
| PubChem CID | 154110369 |
| Molecular Formula | C13H27NO7Si |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | dimethyl 2-[2,2-dimethoxyethoxysilyl(propyl)amino]butanedioate |
| SMILES | CCCN([SiH2]OCC(OC)OC)C(CC(=O)OC)C(=O)OC |
| InChI | InChI=1S/C13H27NO7Si/c1-6-7-14(22-21-9-12(18-3)19-4)10(13(16)20-5)8-11(15)17-2/h10,12H,6-9,22H2,1-5H3 |
| InChIKey | MJQIOAGDWIWKCN-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 2-[2,2-dimethoxyethoxysilyl(propyl)amino]butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 2-[2,2-dimethoxyethoxysilyl(propyl)amino]butanedioate?
The IUPAC name of dimethyl 2-[2,2-dimethoxyethoxysilyl(propyl)amino]butanedioate (CID 154110369) is dimethyl 2-[2,2-dimethoxyethoxysilyl(propyl)amino]butanedioate.
What is the SMILES notation for dimethyl 2-[2,2-dimethoxyethoxysilyl(propyl)amino]butanedioate?
The canonical SMILES for dimethyl 2-[2,2-dimethoxyethoxysilyl(propyl)amino]butanedioate is CCCN([SiH2]OCC(OC)OC)C(CC(=O)OC)C(=O)OC.
What is the InChIKey of dimethyl 2-[2,2-dimethoxyethoxysilyl(propyl)amino]butanedioate?
The InChIKey is MJQIOAGDWIWKCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27NO7Si/c1-6-7-14(22-21-9-12(18-3)19-4)10(13(16)20-5)8-11(15)17-2/h10,12H,6-9,22H2,1-5H3.
What are the key properties of dimethyl 2-[2,2-dimethoxyethoxysilyl(propyl)amino]butanedioate?
dimethyl 2-[2,2-dimethoxyethoxysilyl(propyl)amino]butanedioate has a molecular weight of 337.45 g/mol, XLogP of -0.56, 12 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2-[2,2-dimethoxyethoxysilyl(propyl)amino]butanedioate is sourced from PubChem (CID 154110369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).