C10H17N3S — CID 15410228
4-cyclohexyl-1,5-dimethyl-1,2,4-triazol-4-ium-3-thiolate (PubChem CID 15410228) has the molecular formula C10H17N3S and a molecular weight of 211.33 g/mol. Its IUPAC name is 4-cyclohexyl-1,5-dimethyl-1,2,4-triazol-4-ium-3-thiolate.
| Compound Name | 4-cyclohexyl-1,5-dimethyl-1,2,4-triazol-4-ium-3-thiolate |
|---|---|
| PubChem CID | 15410228 |
| Molecular Formula | C10H17N3S |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 4-cyclohexyl-1,5-dimethyl-1,2,4-triazol-4-ium-3-thiolate |
| SMILES | Cc1n(C)nc([S-])[n+]1C1CCCCC1 |
| InChI | InChI=1S/C10H17N3S/c1-8-12(2)11-10(14)13(8)9-6-4-3-5-7-9/h9H,3-7H2,1-2H3 |
| InChIKey | RNOOFKFCPLLXMM-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|