C14H23N3 — CID 164667290
4-cyclohexyl-3-cyclopropyl-5-propyl-1,2,4-triazole (PubChem CID 164667290) has the molecular formula C14H23N3 and a molecular weight of 233.36 g/mol. Its IUPAC name is 4-cyclohexyl-3-cyclopropyl-5-propyl-1,2,4-triazole.
| Compound Name | 4-cyclohexyl-3-cyclopropyl-5-propyl-1,2,4-triazole |
|---|---|
| PubChem CID | 164667290 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | 4-cyclohexyl-3-cyclopropyl-5-propyl-1,2,4-triazole |
| SMILES | CCCc1nnc(C2CC2)n1C1CCCCC1 |
| InChI | InChI=1S/C14H23N3/c1-2-6-13-15-16-14(11-9-10-11)17(13)12-7-4-3-5-8-12/h11-12H,2-10H2,1H3 |
| InChIKey | YFXLVBOMQXXKOG-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |