About ethyl 2-bromo-2-cyanooctanoate
ethyl 2-bromo-2-cyanooctanoate (PubChem CID 154102932) has the molecular formula C11H18BrNO2
and a molecular weight of 276.17 g/mol. Its IUPAC name is ethyl 2-bromo-2-cyanooctanoate.
Molecular Properties
| Compound Name | ethyl 2-bromo-2-cyanooctanoate |
| PubChem CID | 154102932 |
| Molecular Formula | C11H18BrNO2 |
| Molecular Weight | 276.17 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | ethyl 2-bromo-2-cyanooctanoate |
| SMILES | CCCCCCC(Br)(C#N)C(=O)OCC |
| InChI | InChI=1S/C11H18BrNO2/c1-3-5-6-7-8-11(12,9-13)10(14)15-4-2/h3-8H2,1-2H3 |
| InChIKey | RUXWKPXVWREZRF-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.17 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-bromo-2-cyanooctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-bromo-2-cyanooctanoate?
The IUPAC name of ethyl 2-bromo-2-cyanooctanoate (CID 154102932) is ethyl 2-bromo-2-cyanooctanoate.
What is the SMILES notation for ethyl 2-bromo-2-cyanooctanoate?
The canonical SMILES for ethyl 2-bromo-2-cyanooctanoate is CCCCCCC(Br)(C#N)C(=O)OCC.
What is the InChIKey of ethyl 2-bromo-2-cyanooctanoate?
The InChIKey is RUXWKPXVWREZRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18BrNO2/c1-3-5-6-7-8-11(12,9-13)10(14)15-4-2/h3-8H2,1-2H3.
What are the key properties of ethyl 2-bromo-2-cyanooctanoate?
ethyl 2-bromo-2-cyanooctanoate has a molecular weight of 276.17 g/mol, XLogP of 3.18, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-bromo-2-cyanooctanoate is sourced from PubChem (CID 154102932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).