C14H24O7 — CID 154106907
3-[5-hydroxy-2-(2-hydroxypropoxy)hexoxy]carbonylbut-3-enoic acid (PubChem CID 154106907) has the molecular formula C14H24O7 and a molecular weight of 304.34 g/mol. Its IUPAC name is 3-[5-hydroxy-2-(2-hydroxypropoxy)hexoxy]carbonylbut-3-enoic acid.
| Compound Name | 3-[5-hydroxy-2-(2-hydroxypropoxy)hexoxy]carbonylbut-3-enoic acid |
|---|---|
| PubChem CID | 154106907 |
| Molecular Formula | C14H24O7 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 3-[5-hydroxy-2-(2-hydroxypropoxy)hexoxy]carbonylbut-3-enoic acid |
| SMILES | C=C(CC(=O)O)C(=O)OCC(CCC(C)O)OCC(C)O |
| InChI | InChI=1S/C14H24O7/c1-9(6-13(17)18)14(19)21-8-12(5-4-10(2)15)20-7-11(3)16/h10-12,15-16H,1,4-8H2,2-3H3,(H,17,18) |
| InChIKey | HFRKYQZTJKEJAQ-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|