C18H24BrN3O — CID 154106999
5-bromo-2-octyl-6-phenoxypyrimidin-4-amine (PubChem CID 154106999) has the molecular formula C18H24BrN3O and a molecular weight of 378.31 g/mol. Its IUPAC name is 5-bromo-2-octyl-6-phenoxypyrimidin-4-amine.
| Compound Name | 5-bromo-2-octyl-6-phenoxypyrimidin-4-amine |
|---|---|
| PubChem CID | 154106999 |
| Molecular Formula | C18H24BrN3O |
| Molecular Weight | 378.31 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | 5-bromo-2-octyl-6-phenoxypyrimidin-4-amine |
| SMILES | CCCCCCCCc1nc(N)c(Br)c(Oc2ccccc2)n1 |
| InChI | InChI=1S/C18H24BrN3O/c1-2-3-4-5-6-10-13-15-21-17(20)16(19)18(22-15)23-14-11-8-7-9-12-14/h7-9,11-12H,2-6,10,13H2,1H3,(H2,20,21,22) |
| InChIKey | PLXZDYGSQNROQF-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.31 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|