About cycloocten-1-ylurea
cycloocten-1-ylurea (PubChem CID 154107907) has the molecular formula C9H16N2O
and a molecular weight of 168.24 g/mol. Its IUPAC name is cycloocten-1-ylurea.
Molecular Properties
| Compound Name | cycloocten-1-ylurea |
| PubChem CID | 154107907 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | cycloocten-1-ylurea |
| SMILES | NC(=O)NC1=CCCCCCC1 |
| InChI | InChI=1S/C9H16N2O/c10-9(12)11-8-6-4-2-1-3-5-7-8/h6H,1-5,7H2,(H3,10,11,12) |
| InChIKey | DMODXKKZWDTRIU-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cycloocten-1-ylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cycloocten-1-ylurea?
The IUPAC name of cycloocten-1-ylurea (CID 154107907) is cycloocten-1-ylurea.
What is the SMILES notation for cycloocten-1-ylurea?
The canonical SMILES for cycloocten-1-ylurea is NC(=O)NC1=CCCCCCC1.
What is the InChIKey of cycloocten-1-ylurea?
The InChIKey is DMODXKKZWDTRIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O/c10-9(12)11-8-6-4-2-1-3-5-7-8/h6H,1-5,7H2,(H3,10,11,12).
What are the key properties of cycloocten-1-ylurea?
cycloocten-1-ylurea has a molecular weight of 168.24 g/mol, XLogP of 1.89, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cycloocten-1-ylurea is sourced from PubChem (CID 154107907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).