C12H20N2 — CID 162410635
1,2-di(cyclohexen-1-yl)hydrazine (PubChem CID 162410635) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 1,2-di(cyclohexen-1-yl)hydrazine.
| Compound Name | 1,2-di(cyclohexen-1-yl)hydrazine |
|---|---|
| PubChem CID | 162410635 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 1,2-di(cyclohexen-1-yl)hydrazine |
| SMILES | C1=C(NNC2=CCCCC2)CCCC1 |
| InChI | InChI=1S/C12H20N2/c1-3-7-11(8-4-1)13-14-12-9-5-2-6-10-12/h7,9,13-14H,1-6,8,10H2 |
| InChIKey | VPSJKOJAKMXXSR-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|