C27H42N6O3 — CID 90930542
N-[[4,6-bis[(cycloocten-1-ylamino)oxy]-1,3,5-triazin-2-yl]oxy]cycloocten-1-amine (PubChem CID 90930542) has the molecular formula C27H42N6O3 and a molecular weight of 498.67 g/mol. Its IUPAC name is N-[[4,6-bis[(cycloocten-1-ylamino)oxy]-1,3,5-triazin-2-yl]oxy]cycloocten-1-amine.
| Compound Name | N-[[4,6-bis[(cycloocten-1-ylamino)oxy]-1,3,5-triazin-2-yl]oxy]cycloocten-1-amine |
|---|---|
| PubChem CID | 90930542 |
| Molecular Formula | C27H42N6O3 |
| Molecular Weight | 498.67 g/mol |
| Exact Mass | 498.33 |
| IUPAC Name | N-[[4,6-bis[(cycloocten-1-ylamino)oxy]-1,3,5-triazin-2-yl]oxy]cycloocten-1-amine |
| SMILES | C1=C(NOc2nc(ONC3=CCCCCCC3)nc(ONC3=CCCCCCC3)n2)CCCCCC1 |
| InChI | InChI=1S/C27H42N6O3/c1-4-10-16-22(17-11-5-1)31-34-25-28-26(35-32-23-18-12-6-2-7-13-19-23)30-27(29-25)36-33-24-20-14-8-3-9-15-21-24/h16,18,20,31-33H,1-15,17,19,21H2 |
| InChIKey | SZEDVCNOGRPRGI-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 102.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.67 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|