About (cycloocten-1-ylamino) benzenesulfonate
(cycloocten-1-ylamino) benzenesulfonate (PubChem CID 91274866) has the molecular formula C14H19NO3S
and a molecular weight of 281.38 g/mol. Its IUPAC name is (cycloocten-1-ylamino) benzenesulfonate.
Molecular Properties
| Compound Name | (cycloocten-1-ylamino) benzenesulfonate |
| PubChem CID | 91274866 |
| Molecular Formula | C14H19NO3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | (cycloocten-1-ylamino) benzenesulfonate |
| SMILES | O=S(=O)(ONC1=CCCCCCC1)c1ccccc1 |
| InChI | InChI=1S/C14H19NO3S/c16-19(17,14-11-7-4-8-12-14)18-15-13-9-5-2-1-3-6-10-13/h4,7-9,11-12,15H,1-3,5-6,10H2 |
| InChIKey | BMOHQSGHHNORFN-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (cycloocten-1-ylamino) benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (cycloocten-1-ylamino) benzenesulfonate?
The IUPAC name of (cycloocten-1-ylamino) benzenesulfonate (CID 91274866) is (cycloocten-1-ylamino) benzenesulfonate.
What is the SMILES notation for (cycloocten-1-ylamino) benzenesulfonate?
The canonical SMILES for (cycloocten-1-ylamino) benzenesulfonate is O=S(=O)(ONC1=CCCCCCC1)c1ccccc1.
What is the InChIKey of (cycloocten-1-ylamino) benzenesulfonate?
The InChIKey is BMOHQSGHHNORFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO3S/c16-19(17,14-11-7-4-8-12-14)18-15-13-9-5-2-1-3-6-10-13/h4,7-9,11-12,15H,1-3,5-6,10H2.
What are the key properties of (cycloocten-1-ylamino) benzenesulfonate?
(cycloocten-1-ylamino) benzenesulfonate has a molecular weight of 281.38 g/mol, XLogP of 3.13, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (cycloocten-1-ylamino) benzenesulfonate is sourced from PubChem (CID 91274866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).