About (cyclohexen-1-ylamino) benzenesulfonate
(cyclohexen-1-ylamino) benzenesulfonate (PubChem CID 91196759) has the molecular formula C12H15NO3S
and a molecular weight of 253.32 g/mol. Its IUPAC name is (cyclohexen-1-ylamino) benzenesulfonate.
Molecular Properties
| Compound Name | (cyclohexen-1-ylamino) benzenesulfonate |
| PubChem CID | 91196759 |
| Molecular Formula | C12H15NO3S |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | (cyclohexen-1-ylamino) benzenesulfonate |
| SMILES | O=S(=O)(ONC1=CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C12H15NO3S/c14-17(15,12-9-5-2-6-10-12)16-13-11-7-3-1-4-8-11/h2,5-7,9-10,13H,1,3-4,8H2 |
| InChIKey | XRCZCJAMVNIEQQ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (cyclohexen-1-ylamino) benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (cyclohexen-1-ylamino) benzenesulfonate?
The IUPAC name of (cyclohexen-1-ylamino) benzenesulfonate (CID 91196759) is (cyclohexen-1-ylamino) benzenesulfonate.
What is the SMILES notation for (cyclohexen-1-ylamino) benzenesulfonate?
The canonical SMILES for (cyclohexen-1-ylamino) benzenesulfonate is O=S(=O)(ONC1=CCCCC1)c1ccccc1.
What is the InChIKey of (cyclohexen-1-ylamino) benzenesulfonate?
The InChIKey is XRCZCJAMVNIEQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO3S/c14-17(15,12-9-5-2-6-10-12)16-13-11-7-3-1-4-8-11/h2,5-7,9-10,13H,1,3-4,8H2.
What are the key properties of (cyclohexen-1-ylamino) benzenesulfonate?
(cyclohexen-1-ylamino) benzenesulfonate has a molecular weight of 253.32 g/mol, XLogP of 2.35, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (cyclohexen-1-ylamino) benzenesulfonate is sourced from PubChem (CID 91196759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).