C15H20N2O2 — CID 117060208
(cyclohexen-1-ylamino) N-(2,6-dimethylphenyl)carbamate (PubChem CID 117060208) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is (cyclohexen-1-ylamino) N-(2,6-dimethylphenyl)carbamate.
| Compound Name | (cyclohexen-1-ylamino) N-(2,6-dimethylphenyl)carbamate |
|---|---|
| PubChem CID | 117060208 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | (cyclohexen-1-ylamino) N-(2,6-dimethylphenyl)carbamate |
| SMILES | Cc1cccc(C)c1NC(=O)ONC1=CCCCC1 |
| InChI | InChI=1S/C15H20N2O2/c1-11-7-6-8-12(2)14(11)16-15(18)19-17-13-9-4-3-5-10-13/h6-9,17H,3-5,10H2,1-2H3,(H,16,18) |
| InChIKey | KAAKDHKOHDLDMJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|