C18H18N2O6S2 — CID 91405583
[[6-(benzenesulfonyloxyamino)cyclohexa-1,5-dien-1-yl]amino] benzenesulfonate (PubChem CID 91405583) has the molecular formula C18H18N2O6S2 and a molecular weight of 422.48 g/mol. Its IUPAC name is [[6-(benzenesulfonyloxyamino)cyclohexa-1,5-dien-1-yl]amino] benzenesulfonate.
| Compound Name | [[6-(benzenesulfonyloxyamino)cyclohexa-1,5-dien-1-yl]amino] benzenesulfonate |
|---|---|
| PubChem CID | 91405583 |
| Molecular Formula | C18H18N2O6S2 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.06 |
| IUPAC Name | [[6-(benzenesulfonyloxyamino)cyclohexa-1,5-dien-1-yl]amino] benzenesulfonate |
| SMILES | O=S(=O)(ONC1=CCCC=C1NOS(=O)(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H18N2O6S2/c21-27(22,15-9-3-1-4-10-15)25-19-17-13-7-8-14-18(17)20-26-28(23,24)16-11-5-2-6-12-16/h1-6,9-14,19-20H,7-8H2 |
| InChIKey | MEVARYSCTRKYEL-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|