C20H16F6N2O6S2 — CID 91432119
[[6-[[4-(trifluoromethyl)phenyl]sulfonyloxyamino]cyclohexa-1,5-dien-1-yl]amino] 4-(trifluoromethyl)benzenesulfonate (PubChem CID 91432119) has the molecular formula C20H16F6N2O6S2 and a molecular weight of 558.48 g/mol. Its IUPAC name is [[6-[[4-(trifluoromethyl)phenyl]sulfonyloxyamino]cyclohexa-1,5-dien-1-yl]amino] 4-(trifluoromethyl)benzenesulfonate.
| Compound Name | [[6-[[4-(trifluoromethyl)phenyl]sulfonyloxyamino]cyclohexa-1,5-dien-1-yl]amino] 4-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 91432119 |
| Molecular Formula | C20H16F6N2O6S2 |
| Molecular Weight | 558.48 g/mol |
| Exact Mass | 558.04 |
| IUPAC Name | [[6-[[4-(trifluoromethyl)phenyl]sulfonyloxyamino]cyclohexa-1,5-dien-1-yl]amino] 4-(trifluoromethyl)benzenesulfonate |
| SMILES | O=S(=O)(ONC1=CCCC=C1NOS(=O)(=O)c1ccc(C(F)(F)F)cc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H16F6N2O6S2/c21-19(22,23)13-5-9-15(10-6-13)35(29,30)33-27-17-3-1-2-4-18(17)28-34-36(31,32)16-11-7-14(8-12-16)20(24,25)26/h3-12,27-28H,1-2H2 |
| InChIKey | CRFQCUBHYOFFOD-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.48 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|