C16H24Cl2N4O — CID 91521077
N-[(4,6-dichloro-1,3,5-triazin-2-yl)oxy]cyclotridecen-1-amine (PubChem CID 91521077) has the molecular formula C16H24Cl2N4O and a molecular weight of 359.30 g/mol. Its IUPAC name is N-[(4,6-dichloro-1,3,5-triazin-2-yl)oxy]cyclotridecen-1-amine.
| Compound Name | N-[(4,6-dichloro-1,3,5-triazin-2-yl)oxy]cyclotridecen-1-amine |
|---|---|
| PubChem CID | 91521077 |
| Molecular Formula | C16H24Cl2N4O |
| Molecular Weight | 359.30 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | N-[(4,6-dichloro-1,3,5-triazin-2-yl)oxy]cyclotridecen-1-amine |
| SMILES | Clc1nc(Cl)nc(ONC2=CCCCCCCCCCCC2)n1 |
| InChI | InChI=1S/C16H24Cl2N4O/c17-14-19-15(18)21-16(20-14)23-22-13-11-9-7-5-3-1-2-4-6-8-10-12-13/h11,22H,1-10,12H2 |
| InChIKey | MQCSMMCFGVZLNP-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.30 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|