C8H4Cl5N — CID 154109292
1,1-dichloro-N-[dichloro-(4-chlorophenyl)methyl]methanimine (PubChem CID 154109292) has the molecular formula C8H4Cl5N and a molecular weight of 291.39 g/mol. Its IUPAC name is 1,1-dichloro-N-[dichloro-(4-chlorophenyl)methyl]methanimine.
| Compound Name | 1,1-dichloro-N-[dichloro-(4-chlorophenyl)methyl]methanimine |
|---|---|
| PubChem CID | 154109292 |
| Molecular Formula | C8H4Cl5N |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 288.88 |
| IUPAC Name | 1,1-dichloro-N-[dichloro-(4-chlorophenyl)methyl]methanimine |
| SMILES | ClC(Cl)=NC(Cl)(Cl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C8H4Cl5N/c9-6-3-1-5(2-4-6)8(12,13)14-7(10)11/h1-4H |
| InChIKey | YVOSEWWXWROIHF-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|