C14H8O14S4 — CID 154109309
9,10-dioxoanthracene-1,3,6,8-tetrasulfonic acid (PubChem CID 154109309) has the molecular formula C14H8O14S4 and a molecular weight of 528.47 g/mol. Its IUPAC name is 9,10-dioxoanthracene-1,3,6,8-tetrasulfonic acid.
| Compound Name | 9,10-dioxoanthracene-1,3,6,8-tetrasulfonic acid |
|---|---|
| PubChem CID | 154109309 |
| Molecular Formula | C14H8O14S4 |
| Molecular Weight | 528.47 g/mol |
| Exact Mass | 527.88 |
| IUPAC Name | 9,10-dioxoanthracene-1,3,6,8-tetrasulfonic acid |
| SMILES | O=C1c2cc(S(=O)(=O)O)cc(S(=O)(=O)O)c2C(=O)c2c1cc(S(=O)(=O)O)cc2S(=O)(=O)O |
| InChI | InChI=1S/C14H8O14S4/c15-13-7-1-5(29(17,18)19)3-9(31(23,24)25)11(7)14(16)12-8(13)2-6(30(20,21)22)4-10(12)32(26,27)28/h1-4H,(H,17,18,19)(H,20,21,22)(H,23,24,25)(H,26,27,28) |
| InChIKey | JQXSHVKFRPRRHE-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 251.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.47 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|