C18H21NO3 — CID 154112052
[4,5-dimethoxy-2-(propan-2-ylamino)phenyl]-phenylmethanone (PubChem CID 154112052) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is [4,5-dimethoxy-2-(propan-2-ylamino)phenyl]-phenylmethanone.
| Compound Name | [4,5-dimethoxy-2-(propan-2-ylamino)phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 154112052 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | [4,5-dimethoxy-2-(propan-2-ylamino)phenyl]-phenylmethanone |
| SMILES | COc1cc(NC(C)C)c(C(=O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C18H21NO3/c1-12(2)19-15-11-17(22-4)16(21-3)10-14(15)18(20)13-8-6-5-7-9-13/h5-12,19H,1-4H3 |
| InChIKey | WHYZQJNTUMMIHM-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|