C25H21N3O3 — CID 154113699
N-[1-(2-hydroxy-1H-indol-3-yl)-2-oxo-2-(2-phenylethylamino)ethylidene]benzamide (PubChem CID 154113699) has the molecular formula C25H21N3O3 and a molecular weight of 411.46 g/mol. Its IUPAC name is N-[1-(2-hydroxy-1H-indol-3-yl)-2-oxo-2-(2-phenylethylamino)ethylidene]benzamide.
| Compound Name | N-[1-(2-hydroxy-1H-indol-3-yl)-2-oxo-2-(2-phenylethylamino)ethylidene]benzamide |
|---|---|
| PubChem CID | 154113699 |
| Molecular Formula | C25H21N3O3 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | N-[1-(2-hydroxy-1H-indol-3-yl)-2-oxo-2-(2-phenylethylamino)ethylidene]benzamide |
| SMILES | O=C(NCCc1ccccc1)/C(=N\C(=O)c1ccccc1)c1c(O)[nH]c2ccccc12 |
| InChI | InChI=1S/C25H21N3O3/c29-23(18-11-5-2-6-12-18)28-22(21-19-13-7-8-14-20(19)27-24(21)30)25(31)26-16-15-17-9-3-1-4-10-17/h1-14,27,30H,15-16H2,(H,26,31)/b28-22- |
| InChIKey | QBVDECPOSANYHD-SLMZUGIISA-N |
| XLogP | 3.86 |
| TPSA | 94.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|