C21H24N2O — CID 113211551
2-methyl-2-(2-methyl-1H-indol-3-yl)-N-(2-phenylethyl)propanamide (PubChem CID 113211551) has the molecular formula C21H24N2O and a molecular weight of 320.44 g/mol. Its IUPAC name is 2-methyl-2-(2-methyl-1H-indol-3-yl)-N-(2-phenylethyl)propanamide.
| Compound Name | 2-methyl-2-(2-methyl-1H-indol-3-yl)-N-(2-phenylethyl)propanamide |
|---|---|
| PubChem CID | 113211551 |
| Molecular Formula | C21H24N2O |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | 2-methyl-2-(2-methyl-1H-indol-3-yl)-N-(2-phenylethyl)propanamide |
| SMILES | Cc1[nH]c2ccccc2c1C(C)(C)C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C21H24N2O/c1-15-19(17-11-7-8-12-18(17)23-15)21(2,3)20(24)22-14-13-16-9-5-4-6-10-16/h4-12,23H,13-14H2,1-3H3,(H,22,24) |
| InChIKey | HCOSUAWCBYJKTA-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |