C23H19NO2 — CID 154114481
2-methylidene-4-[4-(N-phenylanilino)phenyl]but-3-enoic acid (PubChem CID 154114481) has the molecular formula C23H19NO2 and a molecular weight of 341.41 g/mol. Its IUPAC name is 2-methylidene-4-[4-(N-phenylanilino)phenyl]but-3-enoic acid.
| Compound Name | 2-methylidene-4-[4-(N-phenylanilino)phenyl]but-3-enoic acid |
|---|---|
| PubChem CID | 154114481 |
| Molecular Formula | C23H19NO2 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 2-methylidene-4-[4-(N-phenylanilino)phenyl]but-3-enoic acid |
| SMILES | C=C(C=Cc1ccc(N(c2ccccc2)c2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C23H19NO2/c1-18(23(25)26)12-13-19-14-16-22(17-15-19)24(20-8-4-2-5-9-20)21-10-6-3-7-11-21/h2-17H,1H2,(H,25,26) |
| InChIKey | ZPOFVYOTCYNTLO-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|