C25H21NOS2 — CID 102321514
(E)-1-(1,3-dithiolan-2-ylidene)-4-[4-(N-phenylanilino)phenyl]but-3-en-2-one (PubChem CID 102321514) has the molecular formula C25H21NOS2 and a molecular weight of 415.58 g/mol. Its IUPAC name is (E)-1-(1,3-dithiolan-2-ylidene)-4-[4-(N-phenylanilino)phenyl]but-3-en-2-one.
| Compound Name | (E)-1-(1,3-dithiolan-2-ylidene)-4-[4-(N-phenylanilino)phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 102321514 |
| Molecular Formula | C25H21NOS2 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | (E)-1-(1,3-dithiolan-2-ylidene)-4-[4-(N-phenylanilino)phenyl]but-3-en-2-one |
| SMILES | O=C(C=C1SCCS1)/C=C/c1ccc(N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H21NOS2/c27-24(19-25-28-17-18-29-25)16-13-20-11-14-23(15-12-20)26(21-7-3-1-4-8-21)22-9-5-2-6-10-22/h1-16,19H,17-18H2/b16-13+ |
| InChIKey | LUBJVKCHAWFSIH-DTQAZKPQSA-N |
| XLogP | 7.06 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|