C12H10OS2 — CID 46859110
(E)-1-(1,3-dithietan-2-ylidene)-4-phenylbut-3-en-2-one (PubChem CID 46859110) has the molecular formula C12H10OS2 and a molecular weight of 234.35 g/mol. Its IUPAC name is (E)-1-(1,3-dithietan-2-ylidene)-4-phenylbut-3-en-2-one.
| Compound Name | (E)-1-(1,3-dithietan-2-ylidene)-4-phenylbut-3-en-2-one |
|---|---|
| PubChem CID | 46859110 |
| Molecular Formula | C12H10OS2 |
| Molecular Weight | 234.35 g/mol |
| Exact Mass | 234.02 |
| IUPAC Name | (E)-1-(1,3-dithietan-2-ylidene)-4-phenylbut-3-en-2-one |
| SMILES | O=C(C=C1SCS1)/C=C/c1ccccc1 |
| InChI | InChI=1S/C12H10OS2/c13-11(8-12-14-9-15-12)7-6-10-4-2-1-3-5-10/h1-8H,9H2/b7-6+ |
| InChIKey | SOXDZRSELQWJBE-VOTSOKGWSA-N |
| XLogP | 3.55 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.35 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|