C23H34O6 — CID 154114590
[2-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-1,1,2-trihydroxyethyl] acetate (PubChem CID 154114590) has the molecular formula C23H34O6 and a molecular weight of 406.52 g/mol. Its IUPAC name is [2-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-1,1,2-trihydroxyethyl] acetate.
| Compound Name | [2-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-1,1,2-trihydroxyethyl] acetate |
|---|---|
| PubChem CID | 154114590 |
| Molecular Formula | C23H34O6 |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | [2-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-1,1,2-trihydroxyethyl] acetate |
| SMILES | CC(=O)OC(O)(O)C(O)[C@H]1CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C23H34O6/c1-13(24)29-23(27,28)20(26)19-7-6-17-16-5-4-14-12-15(25)8-10-21(14,2)18(16)9-11-22(17,19)3/h12,16-20,26-28H,4-11H2,1-3H3/t16-,17-,18-,19+,20?,21-,22-/m0/s1 |
| InChIKey | OWAFLMBVQIKCQE-GVWFROBISA-N |
| XLogP | 2.70 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|