C11H7ClN2O3S — CID 154117744
(3-chloro-4-methylphenyl)-(5-nitro-1,3-thiazol-2-yl)methanone (PubChem CID 154117744) has the molecular formula C11H7ClN2O3S and a molecular weight of 282.71 g/mol. Its IUPAC name is (3-chloro-4-methylphenyl)-(5-nitro-1,3-thiazol-2-yl)methanone.
| Compound Name | (3-chloro-4-methylphenyl)-(5-nitro-1,3-thiazol-2-yl)methanone |
|---|---|
| PubChem CID | 154117744 |
| Molecular Formula | C11H7ClN2O3S |
| Molecular Weight | 282.71 g/mol |
| Exact Mass | 281.99 |
| IUPAC Name | (3-chloro-4-methylphenyl)-(5-nitro-1,3-thiazol-2-yl)methanone |
| SMILES | Cc1ccc(C(=O)c2ncc([N+](=O)[O-])s2)cc1Cl |
| InChI | InChI=1S/C11H7ClN2O3S/c1-6-2-3-7(4-8(6)12)10(15)11-13-5-9(18-11)14(16)17/h2-5H,1H3 |
| InChIKey | PPYKSXUJXRHLTL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 73.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.71 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|