C12H10N2O4S — CID 21481571
(4-hydroxy-3,5-dimethylphenyl)-(5-nitro-1,3-thiazol-2-yl)methanone (PubChem CID 21481571) has the molecular formula C12H10N2O4S and a molecular weight of 278.29 g/mol. Its IUPAC name is (4-hydroxy-3,5-dimethylphenyl)-(5-nitro-1,3-thiazol-2-yl)methanone.
| Compound Name | (4-hydroxy-3,5-dimethylphenyl)-(5-nitro-1,3-thiazol-2-yl)methanone |
|---|---|
| PubChem CID | 21481571 |
| Molecular Formula | C12H10N2O4S |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | (4-hydroxy-3,5-dimethylphenyl)-(5-nitro-1,3-thiazol-2-yl)methanone |
| SMILES | Cc1cc(C(=O)c2ncc([N+](=O)[O-])s2)cc(C)c1O |
| InChI | InChI=1S/C12H10N2O4S/c1-6-3-8(4-7(2)10(6)15)11(16)12-13-5-9(19-12)14(17)18/h3-5,15H,1-2H3 |
| InChIKey | OHZINMNRUVXGQV-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 93.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|