C11H10N4O2S — CID 20606890
(2,4-dimethylphenyl)-(5-nitro-1,3-thiazol-2-yl)diazene (PubChem CID 20606890) has the molecular formula C11H10N4O2S and a molecular weight of 262.29 g/mol. Its IUPAC name is (2,4-dimethylphenyl)-(5-nitro-1,3-thiazol-2-yl)diazene.
| Compound Name | (2,4-dimethylphenyl)-(5-nitro-1,3-thiazol-2-yl)diazene |
|---|---|
| PubChem CID | 20606890 |
| Molecular Formula | C11H10N4O2S |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | (2,4-dimethylphenyl)-(5-nitro-1,3-thiazol-2-yl)diazene |
| SMILES | Cc1ccc(/N=N/c2ncc([N+](=O)[O-])s2)c(C)c1 |
| InChI | InChI=1S/C11H10N4O2S/c1-7-3-4-9(8(2)5-7)13-14-11-12-6-10(18-11)15(16)17/h3-6H,1-2H3/b14-13+ |
| InChIKey | LFBCBGMRFDZLJA-BUHFOSPRSA-N |
| XLogP | 4.08 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|