C17H15N7O2S — CID 102222446
N,N-dimethyl-4-[[4-[(5-nitro-1,3-thiazol-2-yl)diazenyl]phenyl]diazenyl]aniline (PubChem CID 102222446) has the molecular formula C17H15N7O2S and a molecular weight of 381.42 g/mol. Its IUPAC name is N,N-dimethyl-4-[[4-[(5-nitro-1,3-thiazol-2-yl)diazenyl]phenyl]diazenyl]aniline.
| Compound Name | N,N-dimethyl-4-[[4-[(5-nitro-1,3-thiazol-2-yl)diazenyl]phenyl]diazenyl]aniline |
|---|---|
| PubChem CID | 102222446 |
| Molecular Formula | C17H15N7O2S |
| Molecular Weight | 381.42 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | N,N-dimethyl-4-[[4-[(5-nitro-1,3-thiazol-2-yl)diazenyl]phenyl]diazenyl]aniline |
| SMILES | CN(C)c1ccc(/N=N/c2ccc(/N=N/c3ncc([N+](=O)[O-])s3)cc2)cc1 |
| InChI | InChI=1S/C17H15N7O2S/c1-23(2)15-9-7-14(8-10-15)20-19-12-3-5-13(6-4-12)21-22-17-18-11-16(27-17)24(25)26/h3-11H,1-2H3/b20-19+,22-21+ |
| InChIKey | DOQVKVACHFLHJJ-DKHHWMATSA-N |
| XLogP | 5.95 |
| TPSA | 108.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.42 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|