C11H13N5O2S2 — CID 158436912
N,N-dimethyl-4-[(5-methylperoxysulfanyl-1,3,4-thiadiazol-2-yl)diazenyl]aniline (PubChem CID 158436912) has the molecular formula C11H13N5O2S2 and a molecular weight of 311.39 g/mol. Its IUPAC name is N,N-dimethyl-4-[(5-methylperoxysulfanyl-1,3,4-thiadiazol-2-yl)diazenyl]aniline.
| Compound Name | N,N-dimethyl-4-[(5-methylperoxysulfanyl-1,3,4-thiadiazol-2-yl)diazenyl]aniline |
|---|---|
| PubChem CID | 158436912 |
| Molecular Formula | C11H13N5O2S2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | N,N-dimethyl-4-[(5-methylperoxysulfanyl-1,3,4-thiadiazol-2-yl)diazenyl]aniline |
| SMILES | COOSc1nnc(/N=N/c2ccc(N(C)C)cc2)s1 |
| InChI | InChI=1S/C11H13N5O2S2/c1-16(2)9-6-4-8(5-7-9)12-13-10-14-15-11(19-10)20-18-17-3/h4-7H,1-3H3/b13-12+ |
| InChIKey | RKYLHUWEHGMMMD-OUKQBFOZSA-N |
| XLogP | 3.60 |
| TPSA | 72.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|