C24H31N7S2 — CID 20761069
N-methyl-4-[[4-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)diazenyl]phenyl]diazenyl]-N-octylaniline (PubChem CID 20761069) has the molecular formula C24H31N7S2 and a molecular weight of 481.70 g/mol. Its IUPAC name is N-methyl-4-[[4-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)diazenyl]phenyl]diazenyl]-N-octylaniline.
| Compound Name | N-methyl-4-[[4-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)diazenyl]phenyl]diazenyl]-N-octylaniline |
|---|---|
| PubChem CID | 20761069 |
| Molecular Formula | C24H31N7S2 |
| Molecular Weight | 481.70 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | N-methyl-4-[[4-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)diazenyl]phenyl]diazenyl]-N-octylaniline |
| SMILES | CCCCCCCCN(C)c1ccc(/N=N/c2ccc(/N=N/c3nnc(SC)s3)cc2)cc1 |
| InChI | InChI=1S/C24H31N7S2/c1-4-5-6-7-8-9-18-31(2)22-16-14-21(15-17-22)26-25-19-10-12-20(13-11-19)27-28-23-29-30-24(32-3)33-23/h10-17H,4-9,18H2,1-3H3/b26-25+,28-27+ |
| InChIKey | DJLKWUTTWYLKJL-PAMTUDGESA-N |
| XLogP | 8.89 |
| TPSA | 78.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.70 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|