C17H17N7S2 — CID 20761070
N,N-dimethyl-4-[[4-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)diazenyl]phenyl]diazenyl]aniline (PubChem CID 20761070) has the molecular formula C17H17N7S2 and a molecular weight of 383.51 g/mol. Its IUPAC name is N,N-dimethyl-4-[[4-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)diazenyl]phenyl]diazenyl]aniline.
| Compound Name | N,N-dimethyl-4-[[4-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)diazenyl]phenyl]diazenyl]aniline |
|---|---|
| PubChem CID | 20761070 |
| Molecular Formula | C17H17N7S2 |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | N,N-dimethyl-4-[[4-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)diazenyl]phenyl]diazenyl]aniline |
| SMILES | CSc1nnc(/N=N/c2ccc(/N=N/c3ccc(N(C)C)cc3)cc2)s1 |
| InChI | InChI=1S/C17H17N7S2/c1-24(2)15-10-8-14(9-11-15)19-18-12-4-6-13(7-5-12)20-21-16-22-23-17(25-3)26-16/h4-11H,1-3H3/b19-18+,21-20+ |
| InChIKey | CWUNNKRBONYBJP-HYGARKJASA-N |
| XLogP | 6.16 |
| TPSA | 78.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|