C13H13N3O2S — CID 14931796
N,N-dimethyl-4-[(E)-2-(5-nitro-1,3-thiazol-2-yl)ethenyl]aniline (PubChem CID 14931796) has the molecular formula C13H13N3O2S and a molecular weight of 275.33 g/mol. Its IUPAC name is N,N-dimethyl-4-[(E)-2-(5-nitro-1,3-thiazol-2-yl)ethenyl]aniline.
| Compound Name | N,N-dimethyl-4-[(E)-2-(5-nitro-1,3-thiazol-2-yl)ethenyl]aniline |
|---|---|
| PubChem CID | 14931796 |
| Molecular Formula | C13H13N3O2S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | N,N-dimethyl-4-[(E)-2-(5-nitro-1,3-thiazol-2-yl)ethenyl]aniline |
| SMILES | CN(C)c1ccc(/C=C/c2ncc([N+](=O)[O-])s2)cc1 |
| InChI | InChI=1S/C13H13N3O2S/c1-15(2)11-6-3-10(4-7-11)5-8-12-14-9-13(19-12)16(17)18/h3-9H,1-2H3/b8-5+ |
| InChIKey | RQWKSOJQHIYFES-VMPITWQZSA-N |
| XLogP | 3.29 |
| TPSA | 59.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|