C7H7ClN2O2S — CID 170498813
2-(4-chlorobut-1-enyl)-5-nitro-1,3-thiazole (PubChem CID 170498813) has the molecular formula C7H7ClN2O2S and a molecular weight of 218.66 g/mol. Its IUPAC name is 2-(4-chlorobut-1-enyl)-5-nitro-1,3-thiazole.
| Compound Name | 2-(4-chlorobut-1-enyl)-5-nitro-1,3-thiazole |
|---|---|
| PubChem CID | 170498813 |
| Molecular Formula | C7H7ClN2O2S |
| Molecular Weight | 218.66 g/mol |
| Exact Mass | 217.99 |
| IUPAC Name | 2-(4-chlorobut-1-enyl)-5-nitro-1,3-thiazole |
| SMILES | O=[N+]([O-])c1cnc(C=CCCCl)s1 |
| InChI | InChI=1S/C7H7ClN2O2S/c8-4-2-1-3-6-9-5-7(13-6)10(11)12/h1,3,5H,2,4H2 |
| InChIKey | YGFNLCCQZSWIAA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.66 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|