C8H8ClNO2S — CID 169477395
methyl 2-(3-chloroprop-1-enyl)-1,3-thiazole-5-carboxylate (PubChem CID 169477395) has the molecular formula C8H8ClNO2S and a molecular weight of 217.68 g/mol. Its IUPAC name is methyl 2-(3-chloroprop-1-enyl)-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 2-(3-chloroprop-1-enyl)-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 169477395 |
| Molecular Formula | C8H8ClNO2S |
| Molecular Weight | 217.68 g/mol |
| Exact Mass | 217.00 |
| IUPAC Name | methyl 2-(3-chloroprop-1-enyl)-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1cnc(C=CCCl)s1 |
| InChI | InChI=1S/C8H8ClNO2S/c1-12-8(11)6-5-10-7(13-6)3-2-4-9/h2-3,5H,4H2,1H3 |
| InChIKey | OYLBNOUPBQZHHA-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.68 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|