C8H6N2O2S — CID 169483521
methyl 2-(2-cyanoethenyl)-1,3-thiazole-5-carboxylate (PubChem CID 169483521) has the molecular formula C8H6N2O2S and a molecular weight of 194.22 g/mol. Its IUPAC name is methyl 2-(2-cyanoethenyl)-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 2-(2-cyanoethenyl)-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 169483521 |
| Molecular Formula | C8H6N2O2S |
| Molecular Weight | 194.22 g/mol |
| Exact Mass | 194.01 |
| IUPAC Name | methyl 2-(2-cyanoethenyl)-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1cnc(C=CC#N)s1 |
| InChI | InChI=1S/C8H6N2O2S/c1-12-8(11)6-5-10-7(13-6)3-2-4-9/h2-3,5H,1H3 |
| InChIKey | GJBQFYBTFRNPCL-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.22 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|