C5H6N2O3S2 — CID 142522893
methyl 2-sulfinamoyl-1,3-thiazole-5-carboxylate (PubChem CID 142522893) has the molecular formula C5H6N2O3S2 and a molecular weight of 206.25 g/mol. Its IUPAC name is methyl 2-sulfinamoyl-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 2-sulfinamoyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 142522893 |
| Molecular Formula | C5H6N2O3S2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 205.98 |
| IUPAC Name | methyl 2-sulfinamoyl-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1cnc(S(N)=O)s1 |
| InChI | InChI=1S/C5H6N2O3S2/c1-10-4(8)3-2-7-5(11-3)12(6)9/h2H,6H2,1H3 |
| InChIKey | FTSFTDQQQGCGHB-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |